C24H25N3O4S2 — CID 25237388
1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-(2,4-dimethoxyphenyl)thiourea (PubChem CID 25237388) has the molecular formula C24H25N3O4S2 and a molecular weight of 483.62 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-(2,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-(2,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 25237388 |
| Molecular Formula | C24H25N3O4S2 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-(2,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)Nc2ccc(S(=O)(=O)N3CCCc4ccccc43)cc2)c(OC)c1 |
| InChI | InChI=1S/C24H25N3O4S2/c1-30-19-11-14-21(23(16-19)31-2)26-24(32)25-18-9-12-20(13-10-18)33(28,29)27-15-5-7-17-6-3-4-8-22(17)27/h3-4,6,8-14,16H,5,7,15H2,1-2H3,(H2,25,26,32) |
| InChIKey | ZNPXWPOTTZICDY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|