C24H25N3O2S2 — CID 25237345
1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-(2,3-dimethylphenyl)thiourea (PubChem CID 25237345) has the molecular formula C24H25N3O2S2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-(2,3-dimethylphenyl)thiourea.
| Compound Name | 1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-(2,3-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 25237345 |
| Molecular Formula | C24H25N3O2S2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-(2,3-dimethylphenyl)thiourea |
| SMILES | Cc1cccc(NC(=S)Nc2ccc(S(=O)(=O)N3CCCc4ccccc43)cc2)c1C |
| InChI | InChI=1S/C24H25N3O2S2/c1-17-7-5-10-22(18(17)2)26-24(30)25-20-12-14-21(15-13-20)31(28,29)27-16-6-9-19-8-3-4-11-23(19)27/h3-5,7-8,10-15H,6,9,16H2,1-2H3,(H2,25,26,30) |
| InChIKey | PRYKWXMZVKRADF-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|