C26H30N2O4S2 — CID 17264573
N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-2,3,4,5,6-pentamethylbenzenesulfonamide (PubChem CID 17264573) has the molecular formula C26H30N2O4S2 and a molecular weight of 498.67 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-2,3,4,5,6-pentamethylbenzenesulfonamide.
| Compound Name | N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
|---|---|
| PubChem CID | 17264573 |
| Molecular Formula | C26H30N2O4S2 |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-2,3,4,5,6-pentamethylbenzenesulfonamide |
| SMILES | Cc1c(C)c(C)c(S(=O)(=O)Nc2ccc(S(=O)(=O)N3CCCc4ccccc43)cc2)c(C)c1C |
| InChI | InChI=1S/C26H30N2O4S2/c1-17-18(2)20(4)26(21(5)19(17)3)33(29,30)27-23-12-14-24(15-13-23)34(31,32)28-16-8-10-22-9-6-7-11-25(22)28/h6-7,9,11-15,27H,8,10,16H2,1-5H3 |
| InChIKey | BWGOKKDETWQCMW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |