C15H7Cl2NO4 — CID 131107493
3,5-dichloro-2-(1,3-dioxoisoindol-2-yl)benzoic acid (PubChem CID 131107493) has the molecular formula C15H7Cl2NO4 and a molecular weight of 336.13 g/mol. Its IUPAC name is 3,5-dichloro-2-(1,3-dioxoisoindol-2-yl)benzoic acid.
| Compound Name | 3,5-dichloro-2-(1,3-dioxoisoindol-2-yl)benzoic acid |
|---|---|
| PubChem CID | 131107493 |
| Molecular Formula | C15H7Cl2NO4 |
| Molecular Weight | 336.13 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 3,5-dichloro-2-(1,3-dioxoisoindol-2-yl)benzoic acid |
| SMILES | O=C(O)c1cc(Cl)cc(Cl)c1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H7Cl2NO4/c16-7-5-10(15(21)22)12(11(17)6-7)18-13(19)8-3-1-2-4-9(8)14(18)20/h1-6H,(H,21,22) |
| InChIKey | CDISOAJCUNSIBL-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.13 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|