C18H20N4O3 — CID 72838254
N,1,3-trimethyl-N-[(3-methyl-1H-indol-2-yl)methyl]-2,6-dioxopyrimidine-4-carboxamide (PubChem CID 72838254) has the molecular formula C18H20N4O3 and a molecular weight of 340.38 g/mol. Its IUPAC name is N,1,3-trimethyl-N-[(3-methyl-1H-indol-2-yl)methyl]-2,6-dioxopyrimidine-4-carboxamide.
| Compound Name | N,1,3-trimethyl-N-[(3-methyl-1H-indol-2-yl)methyl]-2,6-dioxopyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 72838254 |
| Molecular Formula | C18H20N4O3 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | N,1,3-trimethyl-N-[(3-methyl-1H-indol-2-yl)methyl]-2,6-dioxopyrimidine-4-carboxamide |
| SMILES | Cc1c(CN(C)C(=O)c2cc(=O)n(C)c(=O)n2C)[nH]c2ccccc12 |
| InChI | InChI=1S/C18H20N4O3/c1-11-12-7-5-6-8-13(12)19-14(11)10-20(2)17(24)15-9-16(23)22(4)18(25)21(15)3/h5-9,19H,10H2,1-4H3 |
| InChIKey | DJIFTQBZILUHCY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 80.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|