About 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole
3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole (PubChem CID 143131561) has the molecular formula C16H15N3
and a molecular weight of 249.32 g/mol. Its IUPAC name is 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole.
Molecular Properties
| Compound Name | 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole |
| PubChem CID | 143131561 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole |
| SMILES | C=C/C=C\c1cnc(-c2c(C)[nH]c3ccccc23)[nH]1 |
| InChI | InChI=1S/C16H15N3/c1-3-4-7-12-10-17-16(19-12)15-11(2)18-14-9-6-5-8-13(14)15/h3-10,18H,1H2,2H3,(H,17,19)/b7-4- |
| InChIKey | SXQUVMWVLJFNGQ-DAXSKMNVSA-N |
| XLogP | 4.07 |
| TPSA | 44.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole?
The IUPAC name of 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole (CID 143131561) is 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole.
What is the SMILES notation for 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole?
The canonical SMILES for 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole is C=C/C=C\c1cnc(-c2c(C)[nH]c3ccccc23)[nH]1.
What is the InChIKey of 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole?
The InChIKey is SXQUVMWVLJFNGQ-DAXSKMNVSA-N. The full InChI is InChI=1S/C16H15N3/c1-3-4-7-12-10-17-16(19-12)15-11(2)18-14-9-6-5-8-13(14)15/h3-10,18H,1H2,2H3,(H,17,19)/b7-4-.
What are the key properties of 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole?
3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole has a molecular weight of 249.32 g/mol, XLogP of 4.07, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[(1Z)-buta-1,3-dienyl]-1H-imidazol-2-yl]-2-methyl-1H-indole is sourced from PubChem (CID 143131561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).