C12H15NS — CID 116996346
2-(2,3-dimethyl-1H-indol-5-yl)ethanethiol (PubChem CID 116996346) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1H-indol-5-yl)ethanethiol.
| Compound Name | 2-(2,3-dimethyl-1H-indol-5-yl)ethanethiol |
|---|---|
| PubChem CID | 116996346 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 2-(2,3-dimethyl-1H-indol-5-yl)ethanethiol |
| SMILES | Cc1[nH]c2ccc(CCS)cc2c1C |
| InChI | InChI=1S/C12H15NS/c1-8-9(2)13-12-4-3-10(5-6-14)7-11(8)12/h3-4,7,13-14H,5-6H2,1-2H3 |
| InChIKey | QUDBUAWGPWCFFH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|