C12H15N — CID 1209049
2-ethyl-3,5-dimethyl-1H-indole (PubChem CID 1209049) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-ethyl-3,5-dimethyl-1H-indole.
| Compound Name | 2-ethyl-3,5-dimethyl-1H-indole |
|---|---|
| PubChem CID | 1209049 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-ethyl-3,5-dimethyl-1H-indole |
| SMILES | CCc1[nH]c2ccc(C)cc2c1C |
| InChI | InChI=1S/C12H15N/c1-4-11-9(3)10-7-8(2)5-6-12(10)13-11/h5-7,13H,4H2,1-3H3 |
| InChIKey | AOVDIBSCXYCQQF-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|