C19H21N3O — CID 48561239
2-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-2-phenylacetamide (PubChem CID 48561239) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 2-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-2-phenylacetamide.
| Compound Name | 2-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-2-phenylacetamide |
|---|---|
| PubChem CID | 48561239 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 2-[(2,3-dimethyl-1H-indol-5-yl)methylamino]-2-phenylacetamide |
| SMILES | Cc1[nH]c2ccc(CNC(C(N)=O)c3ccccc3)cc2c1C |
| InChI | InChI=1S/C19H21N3O/c1-12-13(2)22-17-9-8-14(10-16(12)17)11-21-18(19(20)23)15-6-4-3-5-7-15/h3-10,18,21-22H,11H2,1-2H3,(H2,20,23) |
| InChIKey | NMSWRDFVSDJVGK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|