C23H26FN3O4S — CID 87877252
2-[[4-[(3-fluorophenyl)methylamino]phenyl]methylamino]-2-phenylacetamide;methanesulfonic acid (PubChem CID 87877252) has the molecular formula C23H26FN3O4S and a molecular weight of 459.54 g/mol. Its IUPAC name is 2-[[4-[(3-fluorophenyl)methylamino]phenyl]methylamino]-2-phenylacetamide;methanesulfonic acid.
| Compound Name | 2-[[4-[(3-fluorophenyl)methylamino]phenyl]methylamino]-2-phenylacetamide;methanesulfonic acid |
|---|---|
| PubChem CID | 87877252 |
| Molecular Formula | C23H26FN3O4S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 2-[[4-[(3-fluorophenyl)methylamino]phenyl]methylamino]-2-phenylacetamide;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.NC(=O)C(NCc1ccc(NCc2cccc(F)c2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H22FN3O.CH4O3S/c23-19-8-4-5-17(13-19)15-25-20-11-9-16(10-12-20)14-26-21(22(24)27)18-6-2-1-3-7-18;1-5(2,3)4/h1-13,21,25-26H,14-15H2,(H2,24,27);1H3,(H,2,3,4) |
| InChIKey | ZQOSDNLYRQJWAX-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|