C20H21NO3 — CID 67870554
ethyl 3-(5-phenylmethoxy-1H-indol-2-yl)propanoate (PubChem CID 67870554) has the molecular formula C20H21NO3 and a molecular weight of 323.39 g/mol. Its IUPAC name is ethyl 3-(5-phenylmethoxy-1H-indol-2-yl)propanoate.
| Compound Name | ethyl 3-(5-phenylmethoxy-1H-indol-2-yl)propanoate |
|---|---|
| PubChem CID | 67870554 |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | ethyl 3-(5-phenylmethoxy-1H-indol-2-yl)propanoate |
| SMILES | CCOC(=O)CCc1cc2cc(OCc3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C20H21NO3/c1-2-23-20(22)11-8-17-12-16-13-18(9-10-19(16)21-17)24-14-15-6-4-3-5-7-15/h3-7,9-10,12-13,21H,2,8,11,14H2,1H3 |
| InChIKey | PDTVJZHANXHSTH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |