C26H25NO3 — CID 22570321
methyl 2-benzyl-3-(5-phenylmethoxy-1H-indol-2-yl)propanoate (PubChem CID 22570321) has the molecular formula C26H25NO3 and a molecular weight of 399.49 g/mol. Its IUPAC name is methyl 2-benzyl-3-(5-phenylmethoxy-1H-indol-2-yl)propanoate.
| Compound Name | methyl 2-benzyl-3-(5-phenylmethoxy-1H-indol-2-yl)propanoate |
|---|---|
| PubChem CID | 22570321 |
| Molecular Formula | C26H25NO3 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | methyl 2-benzyl-3-(5-phenylmethoxy-1H-indol-2-yl)propanoate |
| SMILES | COC(=O)C(Cc1ccccc1)Cc1cc2cc(OCc3ccccc3)ccc2[nH]1 |
| InChI | InChI=1S/C26H25NO3/c1-29-26(28)22(14-19-8-4-2-5-9-19)16-23-15-21-17-24(12-13-25(21)27-23)30-18-20-10-6-3-7-11-20/h2-13,15,17,22,27H,14,16,18H2,1H3 |
| InChIKey | HEIFVVMJXDIHMD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |