C26H35N3O3 — CID 22570317
methyl 2-[[5-[3-(pyridin-2-ylamino)propoxy]-1H-indol-2-yl]methyl]octanoate (PubChem CID 22570317) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is methyl 2-[[5-[3-(pyridin-2-ylamino)propoxy]-1H-indol-2-yl]methyl]octanoate.
| Compound Name | methyl 2-[[5-[3-(pyridin-2-ylamino)propoxy]-1H-indol-2-yl]methyl]octanoate |
|---|---|
| PubChem CID | 22570317 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | methyl 2-[[5-[3-(pyridin-2-ylamino)propoxy]-1H-indol-2-yl]methyl]octanoate |
| SMILES | CCCCCCC(Cc1cc2cc(OCCCNc3ccccn3)ccc2[nH]1)C(=O)OC |
| InChI | InChI=1S/C26H35N3O3/c1-3-4-5-6-10-20(26(30)31-2)17-22-18-21-19-23(12-13-24(21)29-22)32-16-9-15-28-25-11-7-8-14-27-25/h7-8,11-14,18-20,29H,3-6,9-10,15-17H2,1-2H3,(H,27,28) |
| InChIKey | RDSHSSVNXQWXHX-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|