C18H20N2O4 — CID 168593797
6-(2,3-dihydroxypropylamino)-2-ethoxy-10H-acridin-9-one (PubChem CID 168593797) has the molecular formula C18H20N2O4 and a molecular weight of 328.37 g/mol. Its IUPAC name is 6-(2,3-dihydroxypropylamino)-2-ethoxy-10H-acridin-9-one.
| Compound Name | 6-(2,3-dihydroxypropylamino)-2-ethoxy-10H-acridin-9-one |
|---|---|
| PubChem CID | 168593797 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 6-(2,3-dihydroxypropylamino)-2-ethoxy-10H-acridin-9-one |
| SMILES | CCOc1ccc2[nH]c3cc(NCC(O)CO)ccc3c(=O)c2c1 |
| InChI | InChI=1S/C18H20N2O4/c1-2-24-13-4-6-16-15(8-13)18(23)14-5-3-11(7-17(14)20-16)19-9-12(22)10-21/h3-8,12,19,21-22H,2,9-10H2,1H3,(H,20,23) |
| InChIKey | FDDDIFIBQYTZNJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|