C26H36N2O3 — CID 91111251
2,7-bis[3-(propylamino)propoxy]phenanthren-9-ol (PubChem CID 91111251) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 2,7-bis[3-(propylamino)propoxy]phenanthren-9-ol.
| Compound Name | 2,7-bis[3-(propylamino)propoxy]phenanthren-9-ol |
|---|---|
| PubChem CID | 91111251 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 2,7-bis[3-(propylamino)propoxy]phenanthren-9-ol |
| SMILES | CCCNCCCOc1ccc2c(c1)cc(O)c1cc(OCCCNCCC)ccc12 |
| InChI | InChI=1S/C26H36N2O3/c1-3-11-27-13-5-15-30-21-7-9-23-20(17-21)18-26(29)25-19-22(8-10-24(23)25)31-16-6-14-28-12-4-2/h7-10,17-19,27-29H,3-6,11-16H2,1-2H3 |
| InChIKey | SGXZLWXAQJWBQO-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|