C18H25NO4 — CID 139716939
4,7-dibutoxy-3-hydroxy-1-methylquinolin-2-one (PubChem CID 139716939) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is 4,7-dibutoxy-3-hydroxy-1-methylquinolin-2-one.
| Compound Name | 4,7-dibutoxy-3-hydroxy-1-methylquinolin-2-one |
|---|---|
| PubChem CID | 139716939 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4,7-dibutoxy-3-hydroxy-1-methylquinolin-2-one |
| SMILES | CCCCOc1ccc2c(OCCCC)c(O)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C18H25NO4/c1-4-6-10-22-13-8-9-14-15(12-13)19(3)18(21)16(20)17(14)23-11-7-5-2/h8-9,12,20H,4-7,10-11H2,1-3H3 |
| InChIKey | VDKQKIQIKUIUHJ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|