C20H29NO4 — CID 139718425
3,4-dimethoxy-1-methyl-7-octoxyquinolin-2-one (PubChem CID 139718425) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3,4-dimethoxy-1-methyl-7-octoxyquinolin-2-one.
| Compound Name | 3,4-dimethoxy-1-methyl-7-octoxyquinolin-2-one |
|---|---|
| PubChem CID | 139718425 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 3,4-dimethoxy-1-methyl-7-octoxyquinolin-2-one |
| SMILES | CCCCCCCCOc1ccc2c(OC)c(OC)c(=O)n(C)c2c1 |
| InChI | InChI=1S/C20H29NO4/c1-5-6-7-8-9-10-13-25-15-11-12-16-17(14-15)21(2)20(22)19(24-4)18(16)23-3/h11-12,14H,5-10,13H2,1-4H3 |
| InChIKey | VLFNDHOVEMUUNM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|