C18H24O5S — CID 171421254
3,4-diethyl-6-(5-hydroxypentoxy)-1,1-dioxothiochromen-2-one (PubChem CID 171421254) has the molecular formula C18H24O5S and a molecular weight of 352.45 g/mol. Its IUPAC name is 3,4-diethyl-6-(5-hydroxypentoxy)-1,1-dioxothiochromen-2-one.
| Compound Name | 3,4-diethyl-6-(5-hydroxypentoxy)-1,1-dioxothiochromen-2-one |
|---|---|
| PubChem CID | 171421254 |
| Molecular Formula | C18H24O5S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3,4-diethyl-6-(5-hydroxypentoxy)-1,1-dioxothiochromen-2-one |
| SMILES | CCC1=C(CC)c2cc(OCCCCCO)ccc2S(=O)(=O)C1=O |
| InChI | InChI=1S/C18H24O5S/c1-3-14-15(4-2)18(20)24(21,22)17-9-8-13(12-16(14)17)23-11-7-5-6-10-19/h8-9,12,19H,3-7,10-11H2,1-2H3 |
| InChIKey | NATKRVBMVDKPRQ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|