C28H41N5O3 — CID 3503046
[[2,7-bis[3-(diethylamino)propoxy]fluoren-9-ylidene]amino]urea (PubChem CID 3503046) has the molecular formula C28H41N5O3 and a molecular weight of 495.67 g/mol. Its IUPAC name is [[2,7-bis[3-(diethylamino)propoxy]fluoren-9-ylidene]amino]urea.
| Compound Name | [[2,7-bis[3-(diethylamino)propoxy]fluoren-9-ylidene]amino]urea |
|---|---|
| PubChem CID | 3503046 |
| Molecular Formula | C28H41N5O3 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.32 |
| IUPAC Name | [[2,7-bis[3-(diethylamino)propoxy]fluoren-9-ylidene]amino]urea |
| SMILES | CCN(CC)CCCOc1ccc2c(c1)C(=NNC(N)=O)c1cc(OCCCN(CC)CC)ccc1-2 |
| InChI | InChI=1S/C28H41N5O3/c1-5-32(6-2)15-9-17-35-21-11-13-23-24-14-12-22(36-18-10-16-33(7-3)8-4)20-26(24)27(25(23)19-21)30-31-28(29)34/h11-14,19-20H,5-10,15-18H2,1-4H3,(H3,29,31,34) |
| InChIKey | KOVDCHZVNCLFPY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|