C25H35ClN3O3- — CID 53346999
N-[2,7-bis[2-(diethylamino)ethoxy]fluoren-9-ylidene]hydroxylamine chloride (PubChem CID 53346999) has the molecular formula C25H35ClN3O3- and a molecular weight of 461.03 g/mol. Its IUPAC name is N-[2,7-bis[2-(diethylamino)ethoxy]fluoren-9-ylidene]hydroxylamine chloride.
| Compound Name | N-[2,7-bis[2-(diethylamino)ethoxy]fluoren-9-ylidene]hydroxylamine chloride |
|---|---|
| PubChem CID | 53346999 |
| Molecular Formula | C25H35ClN3O3- |
| Molecular Weight | 461.03 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N-[2,7-bis[2-(diethylamino)ethoxy]fluoren-9-ylidene]hydroxylamine chloride |
| SMILES | CCN(CC)CCOc1ccc2c(c1)C(=NO)c1cc(OCCN(CC)CC)ccc1-2.[Cl-] |
| InChI | InChI=1S/C25H35N3O3.ClH/c1-5-27(6-2)13-15-30-19-9-11-21-22-12-10-20(31-16-14-28(7-3)8-4)18-24(22)25(26-29)23(21)17-19;/h9-12,17-18,29H,5-8,13-16H2,1-4H3;1H/p-1 |
| InChIKey | WVAMWZNUSLEVJU-UHFFFAOYSA-M |
| XLogP | 1.34 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.03 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|