About [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea
[[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea (PubChem CID 3952207) has the molecular formula C20H23N3O5
and a molecular weight of 385.42 g/mol. Its IUPAC name is [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea.
Molecular Properties
| Compound Name | [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea |
| PubChem CID | 3952207 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea |
| SMILES | NC(=O)NN=C1c2cc(OCCCO)ccc2-c2ccc(OCCCO)cc21 |
| InChI | InChI=1S/C20H23N3O5/c21-20(26)23-22-19-17-11-13(27-9-1-7-24)3-5-15(17)16-6-4-14(12-18(16)19)28-10-2-8-25/h3-6,11-12,24-25H,1-2,7-10H2,(H3,21,23,26) |
| InChIKey | NDRBDBIZONMUIB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea?
The IUPAC name of [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea (CID 3952207) is [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea.
What is the SMILES notation for [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea?
The canonical SMILES for [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea is NC(=O)NN=C1c2cc(OCCCO)ccc2-c2ccc(OCCCO)cc21.
What is the InChIKey of [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea?
The InChIKey is NDRBDBIZONMUIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O5/c21-20(26)23-22-19-17-11-13(27-9-1-7-24)3-5-15(17)16-6-4-14(12-18(16)19)28-10-2-8-25/h3-6,11-12,24-25H,1-2,7-10H2,(H3,21,23,26).
What are the key properties of [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea?
[[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea has a molecular weight of 385.42 g/mol, XLogP of 1.61, 9 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [[2,7-bis(3-hydroxypropoxy)fluoren-9-ylidene]amino]urea is sourced from PubChem (CID 3952207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).