C27H35N2O8P — CID 142080822
[4-[3-[7-[2-(diethylamino)ethoxy]-9-oxofluoren-2-yl]oxypropyl-hydroxyamino]-2,4-dioxobutyl]-methylphosphinic acid (PubChem CID 142080822) has the molecular formula C27H35N2O8P and a molecular weight of 546.56 g/mol. Its IUPAC name is [4-[3-[7-[2-(diethylamino)ethoxy]-9-oxofluoren-2-yl]oxypropyl-hydroxyamino]-2,4-dioxobutyl]-methylphosphinic acid.
| Compound Name | [4-[3-[7-[2-(diethylamino)ethoxy]-9-oxofluoren-2-yl]oxypropyl-hydroxyamino]-2,4-dioxobutyl]-methylphosphinic acid |
|---|---|
| PubChem CID | 142080822 |
| Molecular Formula | C27H35N2O8P |
| Molecular Weight | 546.56 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | [4-[3-[7-[2-(diethylamino)ethoxy]-9-oxofluoren-2-yl]oxypropyl-hydroxyamino]-2,4-dioxobutyl]-methylphosphinic acid |
| SMILES | CCN(CC)CCOc1ccc2c(c1)C(=O)c1cc(OCCCN(O)C(=O)CC(=O)CP(C)(=O)O)ccc1-2 |
| InChI | InChI=1S/C27H35N2O8P/c1-4-28(5-2)12-14-37-21-8-10-23-22-9-7-20(16-24(22)27(32)25(23)17-21)36-13-6-11-29(33)26(31)15-19(30)18-38(3,34)35/h7-10,16-17,33H,4-6,11-15,18H2,1-3H3,(H,34,35) |
| InChIKey | HRKBILKQGYHMQC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|