C29H42N4O5+2 — CID 4922026
(2-amino-2-oxoethyl)-[2-[7-[2-[(2-amino-2-oxoethyl)-diethylazaniumyl]ethoxy]-9-oxofluoren-2-yl]oxyethyl]-diethylazanium (PubChem CID 4922026) has the molecular formula C29H42N4O5+2 and a molecular weight of 526.68 g/mol. Its IUPAC name is (2-amino-2-oxoethyl)-[2-[7-[2-[(2-amino-2-oxoethyl)-diethylazaniumyl]ethoxy]-9-oxofluoren-2-yl]oxyethyl]-diethylazanium.
| Compound Name | (2-amino-2-oxoethyl)-[2-[7-[2-[(2-amino-2-oxoethyl)-diethylazaniumyl]ethoxy]-9-oxofluoren-2-yl]oxyethyl]-diethylazanium |
|---|---|
| PubChem CID | 4922026 |
| Molecular Formula | C29H42N4O5+2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.31 |
| IUPAC Name | (2-amino-2-oxoethyl)-[2-[7-[2-[(2-amino-2-oxoethyl)-diethylazaniumyl]ethoxy]-9-oxofluoren-2-yl]oxyethyl]-diethylazanium |
| SMILES | CC[N+](CC)(CCOc1ccc2c(c1)C(=O)c1cc(OCC[N+](CC)(CC)CC(N)=O)ccc1-2)CC(N)=O |
| InChI | InChI=1S/C29H40N4O5/c1-5-32(6-2,19-27(30)34)13-15-37-21-9-11-23-24-12-10-22(18-26(24)29(36)25(23)17-21)38-16-14-33(7-3,8-4)20-28(31)35/h9-12,17-18H,5-8,13-16,19-20H2,1-4H3,(H2-2,30,31,34,35)/p+2 |
| InChIKey | UJYXNBOFPRGCQG-UHFFFAOYSA-P |
| XLogP | 2.34 |
| TPSA | 121.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|