C10H12O7S — CID 56989048
2-[3-hydroxy-4-(2-hydroxyacetyl)phenoxy]ethanesulfonic acid (PubChem CID 56989048) has the molecular formula C10H12O7S and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-[3-hydroxy-4-(2-hydroxyacetyl)phenoxy]ethanesulfonic acid.
| Compound Name | 2-[3-hydroxy-4-(2-hydroxyacetyl)phenoxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 56989048 |
| Molecular Formula | C10H12O7S |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 2-[3-hydroxy-4-(2-hydroxyacetyl)phenoxy]ethanesulfonic acid |
| SMILES | O=C(CO)c1ccc(OCCS(=O)(=O)O)cc1O |
| InChI | InChI=1S/C10H12O7S/c11-6-10(13)8-2-1-7(5-9(8)12)17-3-4-18(14,15)16/h1-2,5,11-12H,3-4,6H2,(H,14,15,16) |
| InChIKey | WVBUKGTZOGEHSZ-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|