C20H24O8S — CID 57237268
3-[4-[3-(4-ethoxy-3-hydroxyphenyl)propanoyl]-3-hydroxyphenoxy]propane-1-sulfonic acid (PubChem CID 57237268) has the molecular formula C20H24O8S and a molecular weight of 424.47 g/mol. Its IUPAC name is 3-[4-[3-(4-ethoxy-3-hydroxyphenyl)propanoyl]-3-hydroxyphenoxy]propane-1-sulfonic acid.
| Compound Name | 3-[4-[3-(4-ethoxy-3-hydroxyphenyl)propanoyl]-3-hydroxyphenoxy]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 57237268 |
| Molecular Formula | C20H24O8S |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 3-[4-[3-(4-ethoxy-3-hydroxyphenyl)propanoyl]-3-hydroxyphenoxy]propane-1-sulfonic acid |
| SMILES | CCOc1ccc(CCC(=O)c2ccc(OCCCS(=O)(=O)O)cc2O)cc1O |
| InChI | InChI=1S/C20H24O8S/c1-2-27-20-9-5-14(12-19(20)23)4-8-17(21)16-7-6-15(13-18(16)22)28-10-3-11-29(24,25)26/h5-7,9,12-13,22-23H,2-4,8,10-11H2,1H3,(H,24,25,26) |
| InChIKey | BTDICSYEOHSMIT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|