C27H32ClNO4 — CID 166943158
N-[4,5-bis(3-methylbutoxy)-9-methylidene-10-oxoanthracen-2-yl]-2-chloroacetamide (PubChem CID 166943158) has the molecular formula C27H32ClNO4 and a molecular weight of 470.01 g/mol. Its IUPAC name is N-[4,5-bis(3-methylbutoxy)-9-methylidene-10-oxoanthracen-2-yl]-2-chloroacetamide.
| Compound Name | N-[4,5-bis(3-methylbutoxy)-9-methylidene-10-oxoanthracen-2-yl]-2-chloroacetamide |
|---|---|
| PubChem CID | 166943158 |
| Molecular Formula | C27H32ClNO4 |
| Molecular Weight | 470.01 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | N-[4,5-bis(3-methylbutoxy)-9-methylidene-10-oxoanthracen-2-yl]-2-chloroacetamide |
| SMILES | C=C1c2cccc(OCCC(C)C)c2C(=O)c2c(OCCC(C)C)cc(NC(=O)CCl)cc21 |
| InChI | InChI=1S/C27H32ClNO4/c1-16(2)9-11-32-22-8-6-7-20-18(5)21-13-19(29-24(30)15-28)14-23(33-12-10-17(3)4)26(21)27(31)25(20)22/h6-8,13-14,16-17H,5,9-12,15H2,1-4H3,(H,29,30) |
| InChIKey | VXPPVLIGISWHQO-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.01 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|