C27H33NO5 — CID 158910045
N-[4,5-bis(3-methylbutoxy)-9,10-dioxoanthracen-2-yl]propanamide (PubChem CID 158910045) has the molecular formula C27H33NO5 and a molecular weight of 451.56 g/mol. Its IUPAC name is N-[4,5-bis(3-methylbutoxy)-9,10-dioxoanthracen-2-yl]propanamide.
| Compound Name | N-[4,5-bis(3-methylbutoxy)-9,10-dioxoanthracen-2-yl]propanamide |
|---|---|
| PubChem CID | 158910045 |
| Molecular Formula | C27H33NO5 |
| Molecular Weight | 451.56 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | N-[4,5-bis(3-methylbutoxy)-9,10-dioxoanthracen-2-yl]propanamide |
| SMILES | CCC(=O)Nc1cc(OCCC(C)C)c2c(c1)C(=O)c1cccc(OCCC(C)C)c1C2=O |
| InChI | InChI=1S/C27H33NO5/c1-6-23(29)28-18-14-20-25(22(15-18)33-13-11-17(4)5)27(31)24-19(26(20)30)8-7-9-21(24)32-12-10-16(2)3/h7-9,14-17H,6,10-13H2,1-5H3,(H,28,29) |
| InChIKey | VKKINBFCVOWBKY-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.56 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|