C24H25NO6 — CID 175991995
3-amino-1,8-bis(4-oxopentoxy)anthracene-9,10-dione (PubChem CID 175991995) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is 3-amino-1,8-bis(4-oxopentoxy)anthracene-9,10-dione.
| Compound Name | 3-amino-1,8-bis(4-oxopentoxy)anthracene-9,10-dione |
|---|---|
| PubChem CID | 175991995 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3-amino-1,8-bis(4-oxopentoxy)anthracene-9,10-dione |
| SMILES | CC(=O)CCCOc1cccc2c1C(=O)c1c(OCCCC(C)=O)cc(N)cc1C2=O |
| InChI | InChI=1S/C24H25NO6/c1-14(26)6-4-10-30-19-9-3-8-17-21(19)24(29)22-18(23(17)28)12-16(25)13-20(22)31-11-5-7-15(2)27/h3,8-9,12-13H,4-7,10-11,25H2,1-2H3 |
| InChIKey | DCYKAPILHMKFAJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 112.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|