C20H18O3 — CID 15716447
1-[(E)-hex-2-enoxy]anthracene-9,10-dione (PubChem CID 15716447) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[(E)-hex-2-enoxy]anthracene-9,10-dione.
| Compound Name | 1-[(E)-hex-2-enoxy]anthracene-9,10-dione |
|---|---|
| PubChem CID | 15716447 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 1-[(E)-hex-2-enoxy]anthracene-9,10-dione |
| SMILES | CCC/C=C/COc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H18O3/c1-2-3-4-7-13-23-17-12-8-11-16-18(17)20(22)15-10-6-5-9-14(15)19(16)21/h4-12H,2-3,13H2,1H3/b7-4+ |
| InChIKey | MODAKDOPBZXTQU-QPJJXVBHSA-N |
| XLogP | 4.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|