About 2-hex-2-enoxyphenol
2-hex-2-enoxyphenol (PubChem CID 57375343) has the molecular formula C12H16O2
and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-hex-2-enoxyphenol.
Molecular Properties
| Compound Name | 2-hex-2-enoxyphenol |
| PubChem CID | 57375343 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-hex-2-enoxyphenol |
| SMILES | CCCC=CCOc1ccccc1O |
| InChI | InChI=1S/C12H16O2/c1-2-3-4-7-10-14-12-9-6-5-8-11(12)13/h4-9,13H,2-3,10H2,1H3 |
| InChIKey | RZDBWOOYRPKEGC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-hex-2-enoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hex-2-enoxyphenol?
The IUPAC name of 2-hex-2-enoxyphenol (CID 57375343) is 2-hex-2-enoxyphenol.
What is the SMILES notation for 2-hex-2-enoxyphenol?
The canonical SMILES for 2-hex-2-enoxyphenol is CCCC=CCOc1ccccc1O.
What is the InChIKey of 2-hex-2-enoxyphenol?
The InChIKey is RZDBWOOYRPKEGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2/c1-2-3-4-7-10-14-12-9-6-5-8-11(12)13/h4-9,13H,2-3,10H2,1H3.
What are the key properties of 2-hex-2-enoxyphenol?
2-hex-2-enoxyphenol has a molecular weight of 192.26 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hex-2-enoxyphenol is sourced from PubChem (CID 57375343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).