C16H11NO5 — CID 15757705
methyl 9-methoxy-5,10-dioxobenzo[g]quinoline-4-carboxylate (PubChem CID 15757705) has the molecular formula C16H11NO5 and a molecular weight of 297.27 g/mol. Its IUPAC name is methyl 9-methoxy-5,10-dioxobenzo[g]quinoline-4-carboxylate.
| Compound Name | methyl 9-methoxy-5,10-dioxobenzo[g]quinoline-4-carboxylate |
|---|---|
| PubChem CID | 15757705 |
| Molecular Formula | C16H11NO5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | methyl 9-methoxy-5,10-dioxobenzo[g]quinoline-4-carboxylate |
| SMILES | COC(=O)c1ccnc2c1C(=O)c1cccc(OC)c1C2=O |
| InChI | InChI=1S/C16H11NO5/c1-21-10-5-3-4-8-11(10)15(19)13-12(14(8)18)9(6-7-17-13)16(20)22-2/h3-7H,1-2H3 |
| InChIKey | HGMQWPRTRZUYDJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 82.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|