C22H24N2O8 — CID 10527251
(2S,3S,4S,5S)-N-[2-[(9,10-dioxoanthracen-1-yl)amino]ethyl]-2,3,4,5,6-pentahydroxyhexanamide (PubChem CID 10527251) has the molecular formula C22H24N2O8 and a molecular weight of 444.44 g/mol. Its IUPAC name is (2S,3S,4S,5S)-N-[2-[(9,10-dioxoanthracen-1-yl)amino]ethyl]-2,3,4,5,6-pentahydroxyhexanamide.
| Compound Name | (2S,3S,4S,5S)-N-[2-[(9,10-dioxoanthracen-1-yl)amino]ethyl]-2,3,4,5,6-pentahydroxyhexanamide |
|---|---|
| PubChem CID | 10527251 |
| Molecular Formula | C22H24N2O8 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | (2S,3S,4S,5S)-N-[2-[(9,10-dioxoanthracen-1-yl)amino]ethyl]-2,3,4,5,6-pentahydroxyhexanamide |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCCNC(=O)[C@@H](O)[C@@H](O)[C@@H](O)[C@@H](O)CO)cccc21 |
| InChI | InChI=1S/C22H24N2O8/c25-10-15(26)19(29)20(30)21(31)22(32)24-9-8-23-14-7-3-6-13-16(14)18(28)12-5-2-1-4-11(12)17(13)27/h1-7,15,19-21,23,25-26,29-31H,8-10H2,(H,24,32)/t15-,19-,20-,21-/m0/s1 |
| InChIKey | XFHDSGNNIMJGAU-ZEWNOJEFSA-N |
| XLogP | -1.57 |
| TPSA | 176.42 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|