C30H25N3O3 — CID 10624385
3-[3-[(9,10-dioxoanthracen-1-yl)amino]propyl]-1,1-diphenylurea (PubChem CID 10624385) has the molecular formula C30H25N3O3 and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-[3-[(9,10-dioxoanthracen-1-yl)amino]propyl]-1,1-diphenylurea.
| Compound Name | 3-[3-[(9,10-dioxoanthracen-1-yl)amino]propyl]-1,1-diphenylurea |
|---|---|
| PubChem CID | 10624385 |
| Molecular Formula | C30H25N3O3 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.19 |
| IUPAC Name | 3-[3-[(9,10-dioxoanthracen-1-yl)amino]propyl]-1,1-diphenylurea |
| SMILES | O=C1c2ccccc2C(=O)c2c(NCCCNC(=O)N(c3ccccc3)c3ccccc3)cccc21 |
| InChI | InChI=1S/C30H25N3O3/c34-28-23-15-7-8-16-24(23)29(35)27-25(28)17-9-18-26(27)31-19-10-20-32-30(36)33(21-11-3-1-4-12-21)22-13-5-2-6-14-22/h1-9,11-18,31H,10,19-20H2,(H,32,36) |
| InChIKey | FMULOCXXEWFLLH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|