C23H28N2O9 — CID 86740290
acetic acid;1,4-dihydroxy-5-[2-(2-hydroxypropylamino)ethylamino]anthracene-9,10-dione (PubChem CID 86740290) has the molecular formula C23H28N2O9 and a molecular weight of 476.48 g/mol. Its IUPAC name is acetic acid;1,4-dihydroxy-5-[2-(2-hydroxypropylamino)ethylamino]anthracene-9,10-dione.
| Compound Name | acetic acid;1,4-dihydroxy-5-[2-(2-hydroxypropylamino)ethylamino]anthracene-9,10-dione |
|---|---|
| PubChem CID | 86740290 |
| Molecular Formula | C23H28N2O9 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | acetic acid;1,4-dihydroxy-5-[2-(2-hydroxypropylamino)ethylamino]anthracene-9,10-dione |
| SMILES | CC(=O)O.CC(=O)O.CC(O)CNCCNc1cccc2c1C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C19H20N2O5.2C2H4O2/c1-10(22)9-20-7-8-21-12-4-2-3-11-15(12)19(26)17-14(24)6-5-13(23)16(17)18(11)25;2*1-2(3)4/h2-6,10,20-24H,7-9H2,1H3;2*1H3,(H,3,4) |
| InChIKey | QXPKAFXRWFVDCK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 193.49 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|