C22H24N4O2S — CID 71605188
4,11-bis(3-aminopropylamino)naphtho[2,3-f][1]benzothiole-5,10-dione (PubChem CID 71605188) has the molecular formula C22H24N4O2S and a molecular weight of 408.53 g/mol. Its IUPAC name is 4,11-bis(3-aminopropylamino)naphtho[2,3-f][1]benzothiole-5,10-dione.
| Compound Name | 4,11-bis(3-aminopropylamino)naphtho[2,3-f][1]benzothiole-5,10-dione |
|---|---|
| PubChem CID | 71605188 |
| Molecular Formula | C22H24N4O2S |
| Molecular Weight | 408.53 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 4,11-bis(3-aminopropylamino)naphtho[2,3-f][1]benzothiole-5,10-dione |
| SMILES | NCCCNc1c2c(c(NCCCN)c3sccc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H24N4O2S/c23-8-3-10-25-18-15-7-12-29-22(15)19(26-11-4-9-24)17-16(18)20(27)13-5-1-2-6-14(13)21(17)28/h1-2,5-7,12,25-26H,3-4,8-11,23-24H2 |
| InChIKey | CMZUBLVFGAMKSB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 110.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|