C20H15N3O3 — CID 154139528
1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile (PubChem CID 154139528) has the molecular formula C20H15N3O3 and a molecular weight of 345.36 g/mol. Its IUPAC name is 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile.
| Compound Name | 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 154139528 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile |
| SMILES | CCCCNc1c(C#N)c(C#N)c(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H15N3O3/c1-2-3-8-23-17-13(9-21)14(10-22)20(26)16-15(17)18(24)11-6-4-5-7-12(11)19(16)25/h4-7,23,26H,2-3,8H2,1H3 |
| InChIKey | MNMPHLLSRDBNBR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|