About 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile
1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile (PubChem CID 154139528) has the molecular formula C20H15N3O3
and a molecular weight of 345.36 g/mol. Its IUPAC name is 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile.
Molecular Properties
| Compound Name | 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile |
| PubChem CID | 154139528 |
| Molecular Formula | C20H15N3O3 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile |
| SMILES | CCCCNc1c(C#N)c(C#N)c(O)c2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C20H15N3O3/c1-2-3-8-23-17-13(9-21)14(10-22)20(26)16-15(17)18(24)11-6-4-5-7-12(11)19(16)25/h4-7,23,26H,2-3,8H2,1H3 |
| InChIKey | MNMPHLLSRDBNBR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile?
The IUPAC name of 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile (CID 154139528) is 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile.
What is the SMILES notation for 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile?
The canonical SMILES for 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile is CCCCNc1c(C#N)c(C#N)c(O)c2c1C(=O)c1ccccc1C2=O.
What is the InChIKey of 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile?
The InChIKey is MNMPHLLSRDBNBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O3/c1-2-3-8-23-17-13(9-21)14(10-22)20(26)16-15(17)18(24)11-6-4-5-7-12(11)19(16)25/h4-7,23,26H,2-3,8H2,1H3.
What are the key properties of 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile?
1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile has a molecular weight of 345.36 g/mol, XLogP of 3.12, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(butylamino)-4-hydroxy-9,10-dioxoanthracene-2,3-dicarbonitrile is sourced from PubChem (CID 154139528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).