C28H27NO6 — CID 170384948
[2-[1-(octylcarbamoyloxy)-3-oxoinden-2-yl]-3-oxoinden-1-yl] formate (PubChem CID 170384948) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is [2-[1-(octylcarbamoyloxy)-3-oxoinden-2-yl]-3-oxoinden-1-yl] formate.
| Compound Name | [2-[1-(octylcarbamoyloxy)-3-oxoinden-2-yl]-3-oxoinden-1-yl] formate |
|---|---|
| PubChem CID | 170384948 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | [2-[1-(octylcarbamoyloxy)-3-oxoinden-2-yl]-3-oxoinden-1-yl] formate |
| SMILES | CCCCCCCCNC(=O)OC1=C(C2=C(OC=O)c3ccccc3C2=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C28H27NO6/c1-2-3-4-5-6-11-16-29-28(33)35-27-21-15-10-8-13-19(21)25(32)23(27)22-24(31)18-12-7-9-14-20(18)26(22)34-17-30/h7-10,12-15,17H,2-6,11,16H2,1H3,(H,29,33) |
| InChIKey | NKUDCUBWXCKPLI-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|