C15H13NO — CID 15447110
1-amino-3,7-dimethylfluoren-9-one (PubChem CID 15447110) has the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. Its IUPAC name is 1-amino-3,7-dimethylfluoren-9-one.
| Compound Name | 1-amino-3,7-dimethylfluoren-9-one |
|---|---|
| PubChem CID | 15447110 |
| Molecular Formula | C15H13NO |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 1-amino-3,7-dimethylfluoren-9-one |
| SMILES | Cc1ccc2c(c1)C(=O)c1c(N)cc(C)cc1-2 |
| InChI | InChI=1S/C15H13NO/c1-8-3-4-10-11-6-9(2)7-13(16)14(11)15(17)12(10)5-8/h3-7H,16H2,1-2H3 |
| InChIKey | ABUDNCBSLGYYDG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|