C18H19NO4 — CID 170008593
3-[(1-methyl-5,9-dioxo-7,8-dihydro-6H-benzo[7]annulen-6-yl)methyl]piperidine-2,6-dione (PubChem CID 170008593) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-[(1-methyl-5,9-dioxo-7,8-dihydro-6H-benzo[7]annulen-6-yl)methyl]piperidine-2,6-dione.
| Compound Name | 3-[(1-methyl-5,9-dioxo-7,8-dihydro-6H-benzo[7]annulen-6-yl)methyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170008593 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-[(1-methyl-5,9-dioxo-7,8-dihydro-6H-benzo[7]annulen-6-yl)methyl]piperidine-2,6-dione |
| SMILES | Cc1cccc2c1C(=O)CCC(CC1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C18H19NO4/c1-10-3-2-4-13-16(10)14(20)7-5-11(17(13)22)9-12-6-8-15(21)19-18(12)23/h2-4,11-12H,5-9H2,1H3,(H,19,21,23) |
| InChIKey | MKMQXOORMYJGQZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|