C13H16O — CID 58222648
4-ethyl-8-methyl-3,4-dihydro-2H-naphthalen-1-one (PubChem CID 58222648) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 4-ethyl-8-methyl-3,4-dihydro-2H-naphthalen-1-one.
| Compound Name | 4-ethyl-8-methyl-3,4-dihydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 58222648 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-ethyl-8-methyl-3,4-dihydro-2H-naphthalen-1-one |
| SMILES | CCC1CCC(=O)c2c(C)cccc21 |
| InChI | InChI=1S/C13H16O/c1-3-10-7-8-12(14)13-9(2)5-4-6-11(10)13/h4-6,10H,3,7-8H2,1-2H3 |
| InChIKey | HQEUUQQHAIPBEZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |