C17H14F2O — CID 10978594
(8R,10R)-8,10-difluoro-3,15-dimethyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-9-one (PubChem CID 10978594) has the molecular formula C17H14F2O and a molecular weight of 272.29 g/mol. Its IUPAC name is (8R,10R)-8,10-difluoro-3,15-dimethyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-9-one.
| Compound Name | (8R,10R)-8,10-difluoro-3,15-dimethyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-9-one |
|---|---|
| PubChem CID | 10978594 |
| Molecular Formula | C17H14F2O |
| Molecular Weight | 272.29 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | (8R,10R)-8,10-difluoro-3,15-dimethyltricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-9-one |
| SMILES | Cc1cccc2c1-c1c(C)cccc1[C@@H](F)C(=O)[C@@H]2F |
| InChI | InChI=1S/C17H14F2O/c1-9-5-3-7-11-13(9)14-10(2)6-4-8-12(14)16(19)17(20)15(11)18/h3-8,15-16H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | MGUMXAWXGRLEAG-HZPDHXFCSA-N |
| XLogP | 4.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.29 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |