C16H14Cl2O2S — CID 98162900
(5R,7R)-5,7-dichloro-1,11-dimethyl-5,7-dihydrobenzo[d][2]benzothiepine 6,6-dioxide (PubChem CID 98162900) has the molecular formula C16H14Cl2O2S and a molecular weight of 341.26 g/mol. Its IUPAC name is (5R,7R)-5,7-dichloro-1,11-dimethyl-5,7-dihydrobenzo[d][2]benzothiepine 6,6-dioxide.
| Compound Name | (5R,7R)-5,7-dichloro-1,11-dimethyl-5,7-dihydrobenzo[d][2]benzothiepine 6,6-dioxide |
|---|---|
| PubChem CID | 98162900 |
| Molecular Formula | C16H14Cl2O2S |
| Molecular Weight | 341.26 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | (5R,7R)-5,7-dichloro-1,11-dimethyl-5,7-dihydrobenzo[d][2]benzothiepine 6,6-dioxide |
| SMILES | Cc1cccc2c1-c1c(C)cccc1[C@@H](Cl)S(=O)(=O)[C@@H]2Cl |
| InChI | InChI=1S/C16H14Cl2O2S/c1-9-5-3-7-11-13(9)14-10(2)6-4-8-12(14)16(18)21(19,20)15(11)17/h3-8,15-16H,1-2H3/t15-,16-/m0/s1 |
| InChIKey | FYGPJCRSZRURKX-HOTGVXAUSA-N |
| XLogP | 4.87 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.26 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|