C21H16O4 — CID 11918787
methyl (1S,2R,10S,11S)-16-methyl-9,18-dioxopentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3(8),4,6,12,14,16-hexaene-7-carboxylate (PubChem CID 11918787) has the molecular formula C21H16O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is methyl (1S,2R,10S,11S)-16-methyl-9,18-dioxopentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3(8),4,6,12,14,16-hexaene-7-carboxylate.
| Compound Name | methyl (1S,2R,10S,11S)-16-methyl-9,18-dioxopentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3(8),4,6,12,14,16-hexaene-7-carboxylate |
|---|---|
| PubChem CID | 11918787 |
| Molecular Formula | C21H16O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | methyl (1S,2R,10S,11S)-16-methyl-9,18-dioxopentacyclo[9.7.0.02,10.03,8.012,17]octadeca-3(8),4,6,12,14,16-hexaene-7-carboxylate |
| SMILES | COC(=O)c1cccc2c1C(=O)[C@@H]1[C@H]3c4cccc(C)c4C(=O)[C@@H]3[C@@H]21 |
| InChI | InChI=1S/C21H16O4/c1-9-5-3-6-10-13(9)19(22)17-15(10)18-16(17)11-7-4-8-12(21(24)25-2)14(11)20(18)23/h3-8,15-18H,1-2H3/t15-,16+,17-,18+/m0/s1 |
| InChIKey | JRBVGCBXDKZSGQ-XWTMOSNGSA-N |
| XLogP | 3.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |