C17H14F2O2 — CID 101463871
(8'R,10'R)-8',10'-difluoro-3',15'-dimethylspiro[dioxirane-3,9'-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene] (PubChem CID 101463871) has the molecular formula C17H14F2O2 and a molecular weight of 288.29 g/mol. Its IUPAC name is (8'R,10'R)-8',10'-difluoro-3',15'-dimethylspiro[dioxirane-3,9'-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene].
| Compound Name | (8'R,10'R)-8',10'-difluoro-3',15'-dimethylspiro[dioxirane-3,9'-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene] |
|---|---|
| PubChem CID | 101463871 |
| Molecular Formula | C17H14F2O2 |
| Molecular Weight | 288.29 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | (8'R,10'R)-8',10'-difluoro-3',15'-dimethylspiro[dioxirane-3,9'-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaene] |
| SMILES | Cc1cccc2c1-c1c(C)cccc1[C@@H](F)C1(OO1)[C@@H]2F |
| InChI | InChI=1S/C17H14F2O2/c1-9-5-3-7-11-13(9)14-10(2)6-4-8-12(14)16(19)17(15(11)18)20-21-17/h3-8,15-16H,1-2H3/t15-,16-/m1/s1 |
| InChIKey | ABVABGGUKRGRNI-HZPDHXFCSA-N |
| XLogP | 4.66 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.29 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|