C12H18N2O — CID 174590772
4-(2,3-dimethylphenyl)-2-methyl-1,3-oxazolidin-2-amine (PubChem CID 174590772) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is 4-(2,3-dimethylphenyl)-2-methyl-1,3-oxazolidin-2-amine.
| Compound Name | 4-(2,3-dimethylphenyl)-2-methyl-1,3-oxazolidin-2-amine |
|---|---|
| PubChem CID | 174590772 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | 4-(2,3-dimethylphenyl)-2-methyl-1,3-oxazolidin-2-amine |
| SMILES | Cc1cccc(C2COC(C)(N)N2)c1C |
| InChI | InChI=1S/C12H18N2O/c1-8-5-4-6-10(9(8)2)11-7-15-12(3,13)14-11/h4-6,11,14H,7,13H2,1-3H3 |
| InChIKey | PKOIWJKJNJEDCR-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |