C11H14ClNO2 — CID 171184393
(4R)-4-(2,3-dimethylphenyl)-1,3-oxazolidin-2-one;hydrochloride (PubChem CID 171184393) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is (4R)-4-(2,3-dimethylphenyl)-1,3-oxazolidin-2-one;hydrochloride.
| Compound Name | (4R)-4-(2,3-dimethylphenyl)-1,3-oxazolidin-2-one;hydrochloride |
|---|---|
| PubChem CID | 171184393 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | (4R)-4-(2,3-dimethylphenyl)-1,3-oxazolidin-2-one;hydrochloride |
| SMILES | Cc1cccc([C@@H]2COC(=O)N2)c1C.Cl |
| InChI | InChI=1S/C11H13NO2.ClH/c1-7-4-3-5-9(8(7)2)10-6-14-11(13)12-10;/h3-5,10H,6H2,1-2H3,(H,12,13);1H/t10-;/m0./s1 |
| InChIKey | BDTLNLLWNKHRHS-PPHPATTJSA-N |
| XLogP | 2.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |