C9H8INO2 — CID 130156491
4-(2-iodophenyl)-1,3-oxazolidin-2-one (PubChem CID 130156491) has the molecular formula C9H8INO2 and a molecular weight of 289.07 g/mol. Its IUPAC name is 4-(2-iodophenyl)-1,3-oxazolidin-2-one.
| Compound Name | 4-(2-iodophenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 130156491 |
| Molecular Formula | C9H8INO2 |
| Molecular Weight | 289.07 g/mol |
| Exact Mass | 288.96 |
| IUPAC Name | 4-(2-iodophenyl)-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(c2ccccc2I)CO1 |
| InChI | InChI=1S/C9H8INO2/c10-7-4-2-1-3-6(7)8-5-13-9(12)11-8/h1-4,8H,5H2,(H,11,12) |
| InChIKey | OSIOHODPKPKOOW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.07 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|