C24H26N2O7 — CID 155194213
3-[5-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1,3-dioxophenalen-2-yl]piperidine-2,6-dione (PubChem CID 155194213) has the molecular formula C24H26N2O7 and a molecular weight of 454.48 g/mol. Its IUPAC name is 3-[5-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1,3-dioxophenalen-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1,3-dioxophenalen-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155194213 |
| Molecular Formula | C24H26N2O7 |
| Molecular Weight | 454.48 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 3-[5-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-1,3-dioxophenalen-2-yl]piperidine-2,6-dione |
| SMILES | NCCOCCOCCOc1cc2c3c(cccc3c1)C(=O)C(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H26N2O7/c25-6-7-31-8-9-32-10-11-33-15-12-14-2-1-3-16-20(14)18(13-15)23(29)21(22(16)28)17-4-5-19(27)26-24(17)30/h1-3,12-13,17,21H,4-11,25H2,(H,26,27,30) |
| InChIKey | QJTOGXPRUZORIJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 134.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|