C25H29N3O8 — CID 153385088
5-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione (PubChem CID 153385088) has the molecular formula C25H29N3O8 and a molecular weight of 499.52 g/mol. Its IUPAC name is 5-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione.
| Compound Name | 5-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 153385088 |
| Molecular Formula | C25H29N3O8 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | 5-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]-2-(2,6-dioxopiperidin-3-yl)benzo[de]isoquinoline-1,3-dione |
| SMILES | NCCOCCOCCOCCOc1cc2c3c(cccc3c1)C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C25H29N3O8/c26-6-7-33-8-9-34-10-11-35-12-13-36-17-14-16-2-1-3-18-22(16)19(15-17)25(32)28(24(18)31)20-4-5-21(29)27-23(20)30/h1-3,14-15,20H,4-13,26H2,(H,27,29,30) |
| InChIKey | ZLFRYAMIUYQTLI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 146.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|