C16H14N2O4 — CID 138467250
8-(4-amino-1,3-dioxoinden-2-yl)-6-azaspiro[2.5]octane-5,7-dione (PubChem CID 138467250) has the molecular formula C16H14N2O4 and a molecular weight of 298.30 g/mol. Its IUPAC name is 8-(4-amino-1,3-dioxoinden-2-yl)-6-azaspiro[2.5]octane-5,7-dione.
| Compound Name | 8-(4-amino-1,3-dioxoinden-2-yl)-6-azaspiro[2.5]octane-5,7-dione |
|---|---|
| PubChem CID | 138467250 |
| Molecular Formula | C16H14N2O4 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 8-(4-amino-1,3-dioxoinden-2-yl)-6-azaspiro[2.5]octane-5,7-dione |
| SMILES | Nc1cccc2c1C(=O)C(C1C(=O)NC(=O)CC13CC3)C2=O |
| InChI | InChI=1S/C16H14N2O4/c17-8-3-1-2-7-10(8)14(21)11(13(7)20)12-15(22)18-9(19)6-16(12)4-5-16/h1-3,11-12H,4-6,17H2,(H,18,19,22) |
| InChIKey | IDOQZSBJIPAGKO-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|